![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Dimensions1_correction.html | 29-Oct-2006 02:00 | 8.9K | |
| Equine-terminology_voc.html | 27-Sep-2006 02:00 | 5.0K | |
| Temps3_correction.html | 25-Jun-2006 02:00 | 1.3K | |
| Thumbs.db | 05-Dec-2006 01:00 | 9.0K | |
| Xray.htm | 10-May-2006 02:00 | 43K | |
| Xray1.htm | 10-May-2006 02:00 | 8.9K | |
| Xray2.htm | 10-May-2006 02:00 | 445 | |
| Xray3.htm | 10-May-2006 02:00 | 632 | |
| _notes/ | 05-Nov-2010 17:25 | - | |
| abbreviations_voc.html | 25-Jun-2006 02:00 | 281K | |
| abdomen_cow_voc.html | 04-Dec-2006 01:00 | 4.1K | |
| abdomen_dog_voc.html | 27-Sep-2006 02:00 | 2.9K | |
| abdomen of the cow.htm | 10-May-2006 02:00 | 43K | |
| abdomen of the cow1.htm | 10-May-2006 02:00 | 5.7K | |
| abdomen of the cow2.htm | 10-May-2006 02:00 | 471 | |
| abdomen of the cow3.htm | 10-May-2006 02:00 | 645 | |
| abdomen of the dog.htm | 10-May-2006 02:00 | 43K | |
| abdomen of the dog1.htm | 10-May-2006 02:00 | 9.3K | |
| abdomen of the dog2.htm | 10-May-2006 02:00 | 471 | |
| abdomen of the dog3.htm | 10-May-2006 02:00 | 645 | |
| abréviations.htm | 10-May-2006 02:00 | 44K | |
| abréviations1.htm | 10-May-2006 02:00 | 8.6K | |
| abréviations2.htm | 10-May-2006 02:00 | 487 | |
| abréviations3.htm | 10-May-2006 02:00 | 653 | |
| adverbes_voc.html | 22-Sep-2006 02:00 | 16K | |
| anglais_vet.html | 05-Dec-2006 01:00 | 5.9K | |
| animal_names_voc.html | 22-Sep-2006 02:00 | 32K | |
| animal names.htm | 21-Jun-2006 02:00 | 45K | |
| animal names1.htm | 21-Jun-2006 02:00 | 17K | |
| animal names2.htm | 21-Jun-2006 02:00 | 459 | |
| animal names3.htm | 21-Jun-2006 02:00 | 639 | |
| but_voc.html | 15-Jun-2006 02:00 | 1.8K | |
| cardio_voc.html | 27-Sep-2006 02:00 | 2.2K | |
| cardiology.htm | 25-Jun-2006 02:00 | 43K | |
| cardiology1.htm | 25-Jun-2006 02:00 | 5.4K | |
| cardiology2.htm | 25-Jun-2006 02:00 | 455 | |
| cardiology3.htm | 25-Jun-2006 02:00 | 637 | |
| cesarean section.htm | 10-May-2006 02:00 | 43K | |
| cesarean section1.htm | 10-May-2006 02:00 | 6.6K | |
| cesarean section2.htm | 10-May-2006 02:00 | 467 | |
| cesarean section3.htm | 10-May-2006 02:00 | 643 | |
| comparatif_voc.html | 22-Sep-2006 02:00 | 15K | |
| comparison.htm | 25-Jun-2006 02:00 | 44K | |
| comparison1.htm | 25-Jun-2006 02:00 | 10K | |
| comparison2.htm | 25-Jun-2006 02:00 | 483 | |
| comparison3.htm | 25-Jun-2006 02:00 | 651 | |
| compound_voc.html | 22-Sep-2006 02:00 | 4.1K | |
| compound words.htm | 10-May-2006 02:00 | 44K | |
| compound words1.htm | 10-May-2006 02:00 | 12K | |
| compound words2.htm | 10-May-2006 02:00 | 463 | |
| compound words3.htm | 10-May-2006 02:00 | 641 | |
| dimensions_correction.html | 25-Jun-2006 02:00 | 5.3K | |
| dimensions_voc.html | 22-Sep-2006 02:00 | 7.9K | |
| disease2.htm | 05-Jul-2006 02:00 | 44K | |
| disease21.htm | 05-Jul-2006 02:00 | 12K | |
| disease22.htm | 05-Jul-2006 02:00 | 455 | |
| disease23.htm | 05-Jul-2006 02:00 | 637 | |
| diseases.htm | 05-Jul-2006 02:00 | 44K | |
| diseases1.htm | 05-Jul-2006 02:00 | 11K | |
| diseases2.htm | 05-Jul-2006 02:00 | 451 | |
| diseases3.htm | 05-Jul-2006 02:00 | 635 | |
| diseases_voc.html | 27-Sep-2006 02:00 | 2.2K | |
| dog skeleton.htm | 10-May-2006 02:00 | 43K | |
| dog skeleton1.htm | 10-May-2006 02:00 | 7.3K | |
| dog skeleton2.htm | 10-May-2006 02:00 | 473 | |
| dog skeleton3.htm | 10-May-2006 02:00 | 646 | |
| durée_voc.html | 19-Nov-2006 01:00 | 8.9K | |
| echelle_globale.html | 21-Jun-2006 02:00 | 6.9K | |
| epidemiology.htm | 10-May-2006 02:00 | 43K | |
| epidemiology1.htm | 10-May-2006 02:00 | 6.3K | |
| epidemiology2.htm | 10-May-2006 02:00 | 459 | |
| epidemiology3.htm | 10-May-2006 02:00 | 639 | |
| equine 3.htm | 10-May-2006 02:00 | 43K | |
| equine 31.htm | 10-May-2006 02:00 | 9.5K | |
| equine 32.htm | 10-May-2006 02:00 | 481 | |
| equine 33.htm | 10-May-2006 02:00 | 650 | |
| equine_anatomy_voc.html | 27-Sep-2006 02:00 | 5.8K | |
| equine terminology.htm | 25-Jun-2006 02:00 | 44K | |
| equine terminology1.htm | 25-Jun-2006 02:00 | 15K | |
| equine terminology 2.htm | 10-May-2006 02:00 | 44K | |
| equine terminology2.htm | 25-Jun-2006 02:00 | 475 | |
| equine terminology3.htm | 25-Jun-2006 02:00 | 647 | |
| equine terminology 21.htm | 10-May-2006 02:00 | 7.2K | |
| equine terminology 22.htm | 10-May-2006 02:00 | 475 | |
| equine terminology 23.htm | 10-May-2006 02:00 | 647 | |
| faux_amis_voca.html | 21-Jun-2006 02:00 | 18K | |
| faux amis.htm | 10-May-2006 02:00 | 44K | |
| faux amis1.htm | 10-May-2006 02:00 | 18K | |
| faux amis2.htm | 10-May-2006 02:00 | 453 | |
| faux amis3.htm | 10-May-2006 02:00 | 636 | |
| frequency.htm | 19-Nov-2006 01:00 | 44K | |
| frequency1.htm | 19-Nov-2006 01:00 | 16K | |
| frequency2.htm | 19-Nov-2006 01:00 | 481 | |
| frequency3.htm | 19-Nov-2006 01:00 | 650 | |
| function and purpose.htm | 10-May-2006 02:00 | 43K | |
| function and purpose1.htm | 10-May-2006 02:00 | 5.7K | |
| function and purpose2.htm | 10-May-2006 02:00 | 467 | |
| function and purpose3.htm | 10-May-2006 02:00 | 643 | |
| grammaire.html | 25-Jun-2006 02:00 | 4.2K | |
| housing_kitten.htm | 10-May-2006 02:00 | 47K | |
| housing_kitten1.htm | 10-May-2006 02:00 | 10K | |
| housing_kitten2.htm | 10-May-2006 02:00 | 467 | |
| housing_kitten3.htm | 10-May-2006 02:00 | 643 | |
| housing_kitten_voc.html | 15-Jun-2006 02:00 | 2.5K | |
| infinitif.htm | 15-Jun-2006 02:00 | 44K | |
| infinitif1.htm | 15-Jun-2006 02:00 | 15K | |
| infinitif2.htm | 15-Jun-2006 02:00 | 475 | |
| infinitif3.htm | 15-Jun-2006 02:00 | 647 | |
| infinitif_correction.html | 27-Sep-2006 02:00 | 3.0K | |
| infinitif_voc.html | 07-Nov-2006 01:00 | 6.1K | |
| irregularwords.htm | 07-Nov-2006 01:00 | 43K | |
| irregularwords1.htm | 07-Nov-2006 01:00 | 28K | |
| irregularwords2.htm | 07-Nov-2006 01:00 | 467 | |
| irregularwords3.htm | 07-Nov-2006 01:00 | 643 | |
| measurements ex1.htm | 10-May-2006 02:00 | 44K | |
| measurements ex2.htm | 10-May-2006 02:00 | 44K | |
| measurements ex3.htm | 25-Jun-2006 02:00 | 47K | |
| measurements ex4.htm | 25-Jun-2006 02:00 | 43K | |
| measurements ex11.htm | 10-May-2006 02:00 | 7.7K | |
| measurements ex12.htm | 10-May-2006 02:00 | 459 | |
| measurements ex13.htm | 10-May-2006 02:00 | 639 | |
| measurements ex21.htm | 10-May-2006 02:00 | 5.5K | |
| measurements ex22.htm | 10-May-2006 02:00 | 459 | |
| measurements ex23.htm | 10-May-2006 02:00 | 639 | |
| measurements ex31.htm | 25-Jun-2006 02:00 | 15K | |
| measurements ex32.htm | 25-Jun-2006 02:00 | 459 | |
| measurements ex33.htm | 25-Jun-2006 02:00 | 639 | |
| measurements ex41.htm | 25-Jun-2006 02:00 | 12K | |
| measurements ex42.htm | 25-Jun-2006 02:00 | 459 | |
| measurements ex43.htm | 25-Jun-2006 02:00 | 639 | |
| medecine_veterinaire.html | 27-Sep-2006 02:00 | 4.9K | |
| media/ | 05-Nov-2010 17:25 | - | |
| modaux.htm | 10-May-2006 02:00 | 43K | |
| modaux1.htm | 10-May-2006 02:00 | 18K | |
| modaux2.htm | 10-May-2006 02:00 | 455 | |
| modaux3.htm | 10-May-2006 02:00 | 637 | |
| modaux_correction.html | 25-Jun-2006 02:00 | 3.9K | |
| modaux_voc.html | 22-Sep-2006 02:00 | 9.8K | |
| modification.htm | 25-Jun-2006 02:00 | 44K | |
| modification1.htm | 25-Jun-2006 02:00 | 20K | |
| modification2.htm | 25-Jun-2006 02:00 | 451 | |
| modification3.htm | 25-Jun-2006 02:00 | 635 | |
| objectifs.html | 15-Jun-2006 02:00 | 3.8K | |
| passif.htm | 10-May-2006 02:00 | 43K | |
| passif1.htm | 10-May-2006 02:00 | 7.7K | |
| passif2.htm | 10-May-2006 02:00 | 453 | |
| passif3.htm | 10-May-2006 02:00 | 636 | |
| passif_voc.html | 22-Sep-2006 02:00 | 3.8K | |
| pathology.htm | 10-May-2006 02:00 | 43K | |
| pathology1.htm | 10-May-2006 02:00 | 9.7K | |
| pathology2.htm | 10-May-2006 02:00 | 453 | |
| pathology3.htm | 10-May-2006 02:00 | 636 | |
| pathology_voc.html | 27-Sep-2006 02:00 | 2.0K | |
| pluriel.html | 22-Sep-2006 02:00 | 2.8K | |
| radiology1.htm | 10-May-2006 02:00 | 44K | |
| radiology2.htm | 10-May-2006 02:00 | 44K | |
| radiology 3.htm | 10-May-2006 02:00 | 44K | |
| radiology 4.htm | 10-May-2006 02:00 | 43K | |
| radiology11.htm | 10-May-2006 02:00 | 7.2K | |
| radiology12.htm | 10-May-2006 02:00 | 457 | |
| radiology13.htm | 10-May-2006 02:00 | 638 | |
| radiology21.htm | 10-May-2006 02:00 | 9.3K | |
| radiology22.htm | 10-May-2006 02:00 | 457 | |
| radiology23.htm | 10-May-2006 02:00 | 638 | |
| radiology 31.htm | 10-May-2006 02:00 | 8.3K | |
| radiology 32.htm | 10-May-2006 02:00 | 457 | |
| radiology 33.htm | 10-May-2006 02:00 | 638 | |
| radiology 41.htm | 10-May-2006 02:00 | 5.8K | |
| radiology 42.htm | 10-May-2006 02:00 | 457 | |
| radiology 43.htm | 10-May-2006 02:00 | 638 | |
| sequencing.htm | 25-Jun-2006 02:00 | 44K | |
| sequencing1.htm | 25-Jun-2006 02:00 | 32K | |
| sequencing2.htm | 25-Jun-2006 02:00 | 457 | |
| sequencing3.htm | 25-Jun-2006 02:00 | 638 | |
| sequencing ex2.htm | 10-May-2006 02:00 | 44K | |
| sequencing ex3.htm | 10-May-2006 02:00 | 44K | |
| sequencing ex21.htm | 10-May-2006 02:00 | 19K | |
| sequencing ex22.htm | 10-May-2006 02:00 | 457 | |
| sequencing ex23.htm | 10-May-2006 02:00 | 638 | |
| sequencing ex31.htm | 10-May-2006 02:00 | 10K | |
| sequencing ex32.htm | 10-May-2006 02:00 | 457 | |
| sequencing ex33.htm | 10-May-2006 02:00 | 638 | |
| skeleton_dog.html | 27-Sep-2006 02:00 | 3.1K | |
| surgical_instruments_voc.html | 27-Sep-2006 02:00 | 1.8K | |
| surgical instruments.htm | 25-Jun-2006 02:00 | 44K | |
| surgical instruments1.htm | 25-Jun-2006 02:00 | 8.5K | |
| surgical instruments2.htm | 25-Jun-2006 02:00 | 475 | |
| surgical instruments3.htm | 25-Jun-2006 02:00 | 647 | |
| temps2_correction.html | 25-Jun-2006 02:00 | 4.1K | |
| temps_gram.html | 22-Sep-2006 02:00 | 9.8K | |
| temps_voc.html | 15-Jun-2006 02:00 | 5.7K | |
| termes_anat_voc.html | 27-Sep-2006 02:00 | 2.8K | |
| termes anatomiques.htm | 10-May-2006 02:00 | 44K | |
| termes anatomiques1.htm | 10-May-2006 02:00 | 8.4K | |
| termes anatomiques2.htm | 10-May-2006 02:00 | 503 | |
| termes anatomiques3.htm | 10-May-2006 02:00 | 661 | |
| unites_voc.html | 15-Jun-2006 02:00 | 1.6K | |
| verbes_irreguliers.html | 15-Jun-2006 02:00 | 141K | |
| voc_voc.html | 22-Sep-2006 02:00 | 6.7K | |
| vocabulaire.html | 22-Sep-2006 02:00 | 4.8K | |
| vocabulaire vétérinaire.htm | 10-May-2006 02:00 | 47K | |
| vocabulaire vétérinaire1.htm | 10-May-2006 02:00 | 40K | |
| vocabulaire vétérinaire2.htm | 10-May-2006 02:00 | 487 | |
| vocabulaire vétérinaire3.htm | 10-May-2006 02:00 | 653 | |
| wods_voc.html | 22-Sep-2006 02:00 | 5.3K | |
| words.htm | 10-May-2006 02:00 | 44K | |
| words1.htm | 10-May-2006 02:00 | 18K | |
| words2.htm | 10-May-2006 02:00 | 529 | |
| words3.htm | 10-May-2006 02:00 | 674 | |
| xray_voc.html | 25-Jun-2006 02:00 | 2.5K | |